CAS 4295-04-9: 4-Chloro-6-methoxyquinoline

Description:4-Chloro-6-methoxyquinoline is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a chlorine atom at the 4-position and a methoxy group at the 6-position contributes to its unique chemical properties. This compound typically appears as a yellow to brown solid and is sparingly soluble in water but more soluble in organic solvents such as ethanol and acetone. It exhibits moderate stability under standard conditions but may undergo reactions typical of quinoline derivatives, such as electrophilic substitution or nucleophilic attack due to the electron-withdrawing nature of the chlorine atom. 4-Chloro-6-methoxyquinoline has garnered interest in medicinal chemistry for its potential biological activities, including antimicrobial and antitumor properties. Its synthesis often involves the chlorination of methoxyquinoline derivatives, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity and environmental impact.

Formula:C₁₀H₈ClNO

InChI:InChI=1/C10H8ClNO/c1-13-7-2-3-10-8(6-7)9(11)4-5-12-10/h2-6H,1H3

Found 5 products.

Product data	Purity	Price range	Estimated delivery
4-Chloro-6-methoxyquinoline REF: IN-DA003L5UCAS: 4295-04-9	97%	23.00 €~318.00 €	Mon 14 Apr 25
4-Chloro-6-methoxyquinoline REF: 54-OR3635CAS: 4295-04-9	98%	32.00 €~1,881.00 €	Mon 21 Apr 25
4-Chloro-6-methoxyquinoline REF: 10-F223346CAS: 4295-04-9	95.0%	To inquire	Thu 24 Apr 25
4-Chloro-6-methoxyquinoline REF: 3D-FC13086CAS: 4295-04-9	Min. 95%	153.00 €~1,075.00 €	Tue 10 Jun 25
4-Chloro-6-methoxyquinoline REF: 3D-EAA29504CAS: 4295-04-9	Min. 95%	- - -	Discontinued product