CAS 4295-04-9
:4-Chloro-6-methoxyquinoline
Description:
4-Chloro-6-methoxyquinoline is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a chlorine atom at the 4-position and a methoxy group at the 6-position contributes to its unique chemical properties. This compound typically appears as a yellow to brown solid and is sparingly soluble in water but more soluble in organic solvents such as ethanol and acetone. It exhibits moderate stability under standard conditions but may undergo reactions typical of quinoline derivatives, such as electrophilic substitution or nucleophilic attack due to the electron-withdrawing nature of the chlorine atom. 4-Chloro-6-methoxyquinoline has garnered interest in medicinal chemistry for its potential biological activities, including antimicrobial and antitumor properties. Its synthesis often involves the chlorination of methoxyquinoline derivatives, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity and environmental impact.
Formula:C10H8ClNO
InChI:InChI=1/C10H8ClNO/c1-13-7-2-3-10-8(6-7)9(11)4-5-12-10/h2-6H,1H3
InChI key:BEOVBLPXVFICSP-UHFFFAOYSA-N
SMILES:COc1ccc2c(c1)c(ccn2)Cl
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
4-Chloro-6-methoxyquinoline
CAS:Formula:C10H8ClNOPurity:97%Color and Shape:SolidMolecular weight:193.62964-Chloro-6-methoxyquinoline
CAS:4-Chloro-6-methoxyquinolineFormula:C10H8ClNOPurity:97%Molecular weight:193.634-Chloro-6-methoxyquinoline
CAS:4-Chloro-6-methoxyquinolineFormula:C10H8ClNOPurity:98%Color and Shape:SolidMolecular weight:193.629624-Chloro-6-methoxyquinoline
CAS:4-Chloro-6-methoxyquinoline is an inhibitor of bacterial DNA gyrase. It has antibacterial activity against Gram-positive and Gram-negative bacteria, including Staphylococcus aureus, Enterococcus faecalis, and Pseudomonas aeruginosa. 4-Chloro-6-methoxyquinoline is a synthetic compound that was reinvestigated for its antibacterial activity. It has been shown to be effective in the treatment of Staphylococcal infections. The mechanism of action may involve inhibition of topoisomerase II or interference with the synthesis of DNA by binding to the enzyme bacterial DNA gyrase. Quinidine and cinchonidine are quinine derivatives that have been found to inhibit bacterial DNA gyrase. These compounds are found in the bark of Cinchona species, which includes Cinchona ledgeriana, Cinchona officinalis, and Cinchona succirubFormula:C10H8ClNOPurity:Min. 95%Molecular weight:193.63 g/mol4-Chloro-6-methoxyquinoline
CAS:Formula:C10H8ClNOPurity:95%Color and Shape:SolidMolecular weight:193.63




