CAS 4295-05-0
:4-Chloro-2-methoxyquinoline
Description:
4-Chloro-2-methoxyquinoline is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a chlorine atom at the 4-position and a methoxy group at the 2-position contributes to its unique chemical properties. This compound typically appears as a yellowish to brown solid and is sparingly soluble in water but more soluble in organic solvents such as ethanol and dichloromethane. It exhibits a range of biological activities, making it of interest in medicinal chemistry and pharmaceutical research. The chlorine substituent can enhance the compound's reactivity and influence its interaction with biological targets. Additionally, the methoxy group can affect the compound's electronic properties and steric hindrance, which may play a role in its pharmacological effects. As with many quinoline derivatives, 4-chloro-2-methoxyquinoline may also exhibit fluorescence, making it useful in various analytical applications. Proper handling and safety precautions are essential due to potential toxicity and environmental concerns associated with halogenated compounds.
Formula:C10H8ClNO
InChI:InChI=1S/C10H8ClNO/c1-13-10-6-8(11)7-4-2-3-5-9(7)12-10/h2-6H,1H3
InChI key:InChIKey=NRHZVBQTBUCSQH-UHFFFAOYSA-N
SMILES:ClC=1C2=C(N=C(OC)C1)C=CC=C2
Synonyms:- 2-Methoxy-4-chloroquinoline
- Quinoline, 4-chloro-2-methoxy-
- 4-Chloro-2-methoxyquinoline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Quinoline, 4-chloro-2-methoxy-
CAS:Formula:C10H8ClNOPurity:97%Color and Shape:SolidMolecular weight:193.62964-Chloro-2-methoxyquinoline
CAS:<p>4-Chloro-2-methoxyquinoline is a chemical compound that has been extensively studied for its nucleophilic substitution reactions. It can be used to study the effects of substituents on the kinetics and reactivity of nucleophilic substitution reactions. 4-Chloro-2-methoxyquinoline is a mesomeric compound, which means that it can exist as two different structures: an anion (electron donor) or a cation (electron acceptor). 4-Chloro-2-methoxyquinoline can also interact with thiolates, which are reactive groups found in biomolecules. This interaction allows for the study of the effects of substituents on the kinetics and reactivity of nucleophilic substitution reactions.</p>Formula:C10H8ClNOPurity:Min. 95%Molecular weight:193.63 g/mol



