CAS 42955-22-6

6-ethoxypyridine-2-carboxylic acid

Description:

6-Ethoxypyridine-2-carboxylic acid is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The compound features an ethoxy group (-OCH2CH3) attached to the sixth position of the pyridine ring and a carboxylic acid group (-COOH) at the second position. This structural arrangement contributes to its unique chemical properties, including its ability to participate in various chemical reactions such as esterification and amidation. The presence of both the ethoxy and carboxylic acid functional groups enhances its solubility in polar solvents, making it useful in organic synthesis and as a potential building block in pharmaceuticals. Additionally, the compound may exhibit biological activity, which can be explored for applications in medicinal chemistry. Its CAS number, 42955-22-6, allows for easy identification and reference in chemical databases. Overall, 6-ethoxypyridine-2-carboxylic acid is a versatile compound with potential applications in various fields of chemistry.

Formula: C₈H₉NO₃

InChI: InChI=1/C8H9NO3/c1-2-12-7-5-3-4-6(9-7)8(10)11/h3-5H,2H2,1H3,(H,10,11)

SMILES: CCOc1cccc(C(=O)O)n1

6-ethoxypyridine-2-carboxylic acid

CAS: 42955-22-6

Formula: C₈H₉NO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 167.1620

Ref: IN-DA00BZIA

6-Ethoxypyridine-2-carboxylic acid

CAS: 42955-22-6

6-Ethoxypyridine-2-carboxylic acid

Purity: 95%

Color and Shape: Off-White Powder

Molecular weight: 167.16g/mol

Ref: 54-OR2588

6-Ethoxypyridine-2-carboxylic acid

CAS: 42955-22-6

Formula: C₈H₉NO₃

Purity: 97%

Color and Shape: Solid, Crystalline

Molecular weight: 167.164

Ref: 10-F065882