
CAS 42966-30-3
:Decanoic acid, magnesium salt (2:1)
Description:
Decanoic acid, magnesium salt (2:1), also known as magnesium decanoate, is a metal salt derived from decanoic acid, a medium-chain fatty acid. This compound typically appears as a white to off-white powder or solid and is characterized by its relatively low solubility in water, while being more soluble in organic solvents. The 2:1 ratio indicates that two moles of decanoic acid are associated with one mole of magnesium, which contributes to its unique properties. Magnesium decanoate is often used in various applications, including as a food additive, emulsifier, and stabilizer in pharmaceuticals and cosmetics. It exhibits surfactant properties, which can enhance the dispersion of oils and fats in formulations. Additionally, it may have potential health benefits due to the presence of magnesium, an essential mineral involved in numerous biochemical processes in the body. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H20O2Mg
InChI:InChI=1S/C10H20O2.Mg/c1-2-3-4-5-6-7-8-9-10(11)12;/h2-9H2,1H3,(H,11,12);
InChI key:InChIKey=LOFZNYHYBWWINL-UHFFFAOYSA-N
SMILES:C(CCCCCC)CCC(O)=O.[Mg]
Synonyms:- Decanoic acid, magnesium salt
- Capric acid magnesium salt
- Decanoic acid, magnesium salt (2:1)
- Magnesium decanoate
- Magnesium caprate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Magnesium decanoate
CAS:Magnesium decanoate is a biochemical.Formula:C20H38MgO4Color and Shape:SolidMolecular weight:366.82
