CymitQuimica logo

CAS 429683-46-5

:

Benzenamine, 4-bromo-2-fluoro-6-methyl-

Description:
Benzenamine, 4-bromo-2-fluoro-6-methyl- is an organic compound characterized by its aromatic amine structure, which features a benzene ring substituted with a bromine atom, a fluorine atom, and a methyl group at specific positions. The presence of the amino group (-NH2) indicates that it is an amine, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The bromine and fluorine substituents introduce halogen functionalities that can influence the compound's reactivity and polarity. The methyl group contributes to the overall hydrophobic character of the molecule. This compound may exhibit interesting properties such as varying solubility in organic solvents and potential biological activity, making it of interest in fields like medicinal chemistry and materials science. Its specific structural features can also affect its stability, boiling point, and melting point, which are important for practical applications. As with many substituted anilines, it may also show varying degrees of toxicity and environmental impact, necessitating careful handling and assessment.
Formula:C7H7BrFN
InChI:InChI=1S/C7H7BrFN/c1-4-2-5(8)3-6(9)7(4)10/h2-3H,10H2,1H3
InChI key:SLNCSLAIDQBUKN-UHFFFAOYSA-N
SMILES:CC1=CC(=CC(=C1N)F)Br
Found 5 products.