CymitQuimica logo

CAS 4298-05-9

:

cis-3-hydroxy-dl-proline

Description:
Cis-3-hydroxy-dl-proline is an amino acid derivative characterized by its unique structural features and stereochemistry. It is a cyclic compound that contains a hydroxyl group (-OH) at the 3-position of the proline ring, which contributes to its solubility and reactivity. This compound exists as a racemic mixture, meaning it contains both the D and L enantiomers, which can exhibit different biological activities. Cis-3-hydroxy-dl-proline is known for its role in peptide synthesis and as a building block in the formation of various bioactive compounds. Its hydroxyl group can participate in hydrogen bonding, influencing the compound's interactions in biological systems. Additionally, it has potential applications in pharmaceuticals and materials science due to its structural properties. The compound is typically stable under standard conditions but may undergo transformations under specific chemical environments. Overall, cis-3-hydroxy-dl-proline is a significant compound in both organic chemistry and biochemistry, with implications for research and development in various fields.
Formula:C5H9NO3
InChI:InChI=1/C5H9NO3/c7-3-1-2-6-4(3)5(8)9/h3-4,6-7H,1-2H2,(H,8,9)/t3-,4+/m1/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.