CAS 42982-87-6
:(9S)-9-hydroxy-6'-methoxy-1-methylcinchonan-1-ium iodide
Description:
(9S)-9-hydroxy-6'-methoxy-1-methylcinchonan-1-ium iodide, with the CAS number 42982-87-6, is a quaternary ammonium compound derived from cinchona alkaloids. This substance typically exhibits a chiral center, which contributes to its stereochemical properties and potential biological activity. The presence of the hydroxyl and methoxy groups suggests that it may engage in hydrogen bonding and exhibit solubility in polar solvents. As a quaternary ammonium salt, it is likely to be ionic in nature, which can influence its solubility and reactivity. Such compounds are often studied for their pharmacological properties, including potential use as antimalarial agents or in other therapeutic applications. The iodide counterion may also play a role in the compound's stability and solubility profile. Overall, this compound's unique structural features and functional groups make it of interest in both synthetic and medicinal chemistry contexts.
Formula:C21H27IN2O2
InChI:InChI=1/C21H27N2O2.HI/c1-4-14-13-23(2)10-8-15(14)11-20(23)21(24)17-7-9-22-19-6-5-16(25-3)12-18(17)19;/h4-7,9,12,14-15,20-21,24H,1,8,10-11,13H2,2-3H3;1H/q+1;/p-1/t14-,15?,20+,21-,23?;/m0./s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N-Methyl Quinidine-d3 Iodide
CAS:Formula:C21H24D3N2O2·IColor and Shape:Pale Yellow SolidMolecular weight:342.48 126.90Quinidine Methiodide-d3 (>85%)
CAS:Controlled ProductFormula:C21D3H24N2O2·IPurity:>85%Color and Shape:NeatMolecular weight:469.37Quinidine Methiodide
CAS:Controlled ProductFormula:C21H27IN2O2Color and Shape:Light YellowMolecular weight:466.36Quinidine methiodide
CAS:Quinidine is a drug that has been used in the treatment of cardiac arrhythmias and as an antiarrhythmic. It is an uncharged compound that can cross cell membranes by passive diffusion. Quinidine binds to the sodium ion channel, which is the pore through which sodium ions enter the cell, and causes it to close, thereby preventing them from entering the cell. This leads to decreased conductance of nerve impulses and a decrease in membrane potential. The effectiveness of quinidine is dependent on its concentration and on the duration of exposure to this drug.
Formula:C21H27IN2O2Purity:Min. 95%Molecular weight:466.4 g/molRef: 3D-SBA98287
Discontinued product


