CAS 4299-56-3
:3,6-Diaminohexanoic acid
Description:
3,6-Diaminohexanoic acid, also known as hexamethylenediamine-2,5-dicarboxylic acid, is an organic compound characterized by its two amino groups and two carboxylic acid groups, which contribute to its properties as a diamino acid. It has a linear aliphatic structure with a six-carbon chain, making it a member of the aliphatic amino acids. This compound is typically a white crystalline solid that is soluble in water due to the presence of the polar amino and carboxylic acid functional groups. Its chemical formula is C6H14N2O2, and it has a molecular weight that reflects its composition. 3,6-Diaminohexanoic acid is of interest in various applications, including the synthesis of polyamides and as a building block in the production of biodegradable polymers. Additionally, it can serve as a precursor in the manufacture of pharmaceuticals and agrochemicals. The presence of multiple functional groups allows for diverse reactivity, making it a valuable compound in organic synthesis and materials science.
Formula:C6H14N2O2
InChI:InChI=1/C6H14N2O2/c7-3-1-2-5(8)4-6(9)10/h5H,1-4,7-8H2,(H,9,10)
InChI key:InChIKey=QKEWQOJCHPFEAF-UHFFFAOYSA-N
SMILES:C(C(CCCN)N)C(O)=O
Synonyms:- (+-)-3,6-Diamino-hexanoic acid
- Hexanoic acid, 3,6-diamino-
- Isolysin
- Isolysine
- β-Lysine
- 3,6-Diaminohexanoic acid
- beta-lysine
- 3,6-DIAMINOHEXANOIC ACID DIHYDROCHLORIDE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(R)-β-lysine
CAS:(R) - ß - lysine is a functional modifier of elongation factor P (EF-P).Formula:C6H14N2O2Color and Shape:SolidMolecular weight:146.19
