CAS 4299-57-4
:Plastoquinone
Description:
Plastoquinone is a lipid-soluble molecule that plays a crucial role in the photosynthetic process, particularly in the electron transport chain of chloroplasts. It is a type of quinone, characterized by its long isoprenoid side chain, which enhances its hydrophobic properties, allowing it to move within the thylakoid membrane. Plastoquinone functions as an electron carrier, facilitating the transfer of electrons from photosystem II to the cytochrome b6f complex, thereby contributing to the generation of a proton gradient used for ATP synthesis. Its structure includes a quinone ring, which can undergo redox reactions, allowing it to alternate between oxidized and reduced forms. This compound is essential for the efficient conversion of light energy into chemical energy during photosynthesis. Additionally, plastoquinone is involved in the regulation of various metabolic processes and may have roles in protecting plant cells from oxidative stress. Its CAS number, 4299-57-4, is used for identification in chemical databases and regulatory contexts.
Formula:C53H80O2
InChI:InChI=1S/C53H80O2/c1-40(2)21-13-22-41(3)23-14-24-42(4)25-15-26-43(5)27-16-28-44(6)29-17-30-45(7)31-18-32-46(8)33-19-34-47(9)35-20-36-48(10)37-38-51-39-52(54)49(11)50(12)53(51)55/h21,23,25,27,29,31,33,35,37,39H,13-20,22,24,26,28,30,32,34,36,38H2,1-12H3/b41-23+,42-25+,43-27+,44-29+,45-31+,46-33+,47-35+,48-37+
InChI key:InChIKey=FKUYMLZIRPABFK-IQSNHBBHSA-N
SMILES:C(/C=C(/CC/C=C(/CC/C=C(/CC/C=C(/CC/C=C(/CC/C=C(/CC/C=C(/CC/C=C(/CCC=C(C)C)\C)\C)\C)\C)\C)\C)\C)\C)C=1C(=O)C(C)=C(C)C(=O)C1
Synonyms:- 2,3-Dimethyl-5-[(2E,6E,10E,14E,18E,22E,26E,30E)-3,7,11,15,19,23,27,31,35-nonamethyl-2,6,10,14,18,22,26,30,34-hexatriacontanonaen-1-yl]-2,5-cyclohexadiene-1,4-dione
- 2,3-Dimethyl-5-[(2E,6E,10E,14E,18E,22Z,26E,30E)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,10,14,18,22,26,30,34-nonaen-1-yl]-1,4-benzoquinone
- 2,3-Dimethyl-5-solanesyl-1,4-benzoquinone
- 2,5-Cyclohexadiene-1,4-dione, 2,3-dimethyl-5-(3,7,11,15,19,23,27,31,35-nonamethyl-2,6,10,14,18,22,26,30,34-hexatriacontanonaenyl)-, (all-E)-
- 2,5-Cyclohexadiene-1,4-dione, 2,3-dimethyl-5-[(2E,6E,10E,14E,18E,22E,26E,30E)-3,7,11,15,19,23,27,31,35-nonamethyl-2,6,10,14,18,22,26,30,34-hexatriacontanonaen-1-yl]-
- 2,5-Cyclohexadiene-1,4-dione, 2,3-dimethyl-5-[(2E,6E,10E,14E,18E,22E,26E,30E)-3,7,11,15,19,23,27,31,35-nonamethyl-2,6,10,14,18,22,26,30,34-hexatriacontanonaenyl]-
- 2,5-cyclohexadiene-1,4-dione, 2,3-dimethyl-5-[(2E,6E,10E,14E,18E,22Z,26E,30E)-3,7,11,15,19,23,27,31,35-nonamethyl-2,6,10,14,18,22,26,30,34-hexatriacontanonaen-1-yl]-
- 4299-57-4
- Kofler's quinone
- Koflerquinone 45
- Plastoquinone
- Plastoquinone 45
- Plastoquinone 9
- Plastoquinone A
- Q 254
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Plastoquinone
CAS:Plastoquinone, a polyunsaturated quinone, aids photosynthesis in plants by transferring electrons in the energy conversion process.Formula:C53H80O2Color and Shape:SolidMolecular weight:749.20

