CAS 43002-54-6

(2-phenyl-1H-imidazol-5-yl)methanol

Description:

(2-phenyl-1H-imidazol-5-yl)methanol is an organic compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a phenyl group attached to the imidazole ring, contributing to its aromatic properties. The presence of a hydroxymethyl group (-CH2OH) at the 5-position of the imidazole ring enhances its reactivity and solubility in polar solvents. Typically, compounds like this exhibit biological activity, making them of interest in medicinal chemistry and drug development. They may also participate in hydrogen bonding due to the hydroxyl group, influencing their interactions with other molecules. The compound's structure allows for potential applications in various fields, including pharmaceuticals, where it may serve as a scaffold for the development of new therapeutic agents. Additionally, its unique combination of functional groups may impart specific physical properties, such as melting point and solubility, which are essential for its practical applications.

Formula: C₁₀H₁₀N₂O

InChI: InChI=1/C10H10N2O/c13-7-9-6-11-10(12-9)8-4-2-1-3-5-8/h1-6,13H,7H2,(H,11,12)

SMILES: c1ccc(cc1)c1ncc(CO)[nH]1

4-(Hydroxymethyl)-2-phenyl-1H-imidazole

CAS: 43002-54-6

Formula: C₁₀H₁₀N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 174.1992

Ref: IN-DA00707L

4-(Hydroxymethyl)-2-phenyl-1H-imidazole

CAS: 43002-54-6

4-(Hydroxymethyl)-2-phenyl-1H-imidazole

Purity: 95%

Molecular weight: 174.20g/mol

Ref: 54-OR8526

(2-phenyl-1H-imidazol-5-yl)methanol

CAS: 43002-54-6

Formula: C₁₀H₁₀N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 174.203

Ref: 10-F312163

(2-Phenyl-1H-imidazol-4-yl)methanol

Controlled Product

CAS: 43002-54-6

Formula: C₁₀H₁₀N₂O

Color and Shape: Neat

Molecular weight: 174.2

Ref: TR-P229425