CAS 43019-90-5
:(~2~H_5_)benzoyl chloride
Description:
The chemical substance known as benzoyl chloride, with the CAS number 43019-90-5, is an acyl chloride derived from benzoic acid. It is characterized by its aromatic structure, featuring a benzene ring attached to a carbonyl group (C=O) and a chlorine atom. Benzoyl chloride is a colorless to pale yellow liquid with a pungent odor, and it is highly reactive, particularly with water, alcohols, and amines, leading to the formation of corresponding carboxylic acids, esters, and amides, respectively. This compound is primarily used in organic synthesis as an acylating agent, facilitating the introduction of the benzoyl group into various organic molecules. Due to its reactivity, it must be handled with care, as it can cause severe irritation to the skin, eyes, and respiratory tract. Additionally, benzoyl chloride is soluble in organic solvents but reacts vigorously with water, releasing hydrochloric acid. Its applications extend to the production of pharmaceuticals, dyes, and other chemical intermediates.
Formula:C7D5ClO
InChI:InChI=1/C7H5ClO/c8-7(9)6-4-2-1-3-5-6/h1-5H/i1D,2D,3D,4D,5D
SMILES:c1(c(c(c(c(c1[2H])[2H])C(=O)Cl)[2H])[2H])[2H]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Benzoyl-d5 Chloride
CAS:Formula:C6D5COClPurity:99 atom % DColor and Shape:Colourless. Fuming LiquidMolecular weight:145.03428Benzoyl-d5 Chloride
CAS:Controlled ProductStability Moisture Sensitive
Applications Labelled Benzoyl Chloride. Used in the manufacturing of dye intermediates.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the packageFormula:C72H5ClOColor and Shape:NeatMolecular weight:145.6


