CAS 43024-15-3
:3-amino-4-ethylpyrazole oxalate
Description:
3-Amino-4-ethylpyrazole oxalate is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of an amino group at the 3-position and an ethyl group at the 4-position contributes to its unique reactivity and solubility properties. As an oxalate salt, it is typically formed by the reaction of 3-amino-4-ethylpyrazole with oxalic acid, resulting in a compound that may exhibit different physical and chemical properties compared to its parent base. This substance is often studied for its potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Its solubility in various solvents, stability under different conditions, and reactivity with other chemical species are important characteristics that determine its utility in various chemical processes. Safety data should be consulted for handling and storage, as with any chemical compound, to ensure proper precautions are taken.
Formula:C5H9N3
InChI:InChI=1/C5H9N3/c1-2-4-3-7-8-5(4)6/h3H,2H2,1H3,(H3,6,7,8)
SMILES:CCc1c[nH][nH]c1=N
Synonyms:- 1H-Pyrazol-3-amine, 4-ethyl-
- 3-Amino-4-ethyl-1H-pyrazole
- 4-Ethyl-1H-pyrazol-3-amine
- 4-Ethyl-1H-pyrazol-3-ylamine
- T5Mnj Cz D2 [Wln]
- 4-ethyl-1H-pyrazol-5-amine
- 3-Amino-4-Ethylpyrazole
- 4-ethyl-1(2)H-pyrazol-3-ylaMine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Amino-4-ethyl-1H-pyrazole, 98%
CAS:3-Amino-4-ethyl-1H-pyrazole is employed as a intermediate for chemical research and pharmaceutical. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar
Formula:C5H9N3Purity:98%Molecular weight:111.154-Ethyl-1H-pyrazol-3-amine
CAS:Formula:C5H9N3Purity:95%Color and Shape:SolidMolecular weight:111.1451



