CAS 43024-67-5

Pyrazolo[1,5-a]pyrimidine-3,6-dicarboxylic acid, 7-amino-, diethyl ester

Description:

Pyrazolo[1,5-a]pyrimidine-3,6-dicarboxylic acid, 7-amino-, diethyl ester is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrazole and pyrimidine moieties. This compound features two carboxylic acid groups that are esterified with ethyl groups, enhancing its solubility and reactivity. The presence of the amino group at the 7-position contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound's molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its pharmacological properties. It is typically synthesized through multi-step organic reactions, and its derivatives may exhibit a range of activities, including anti-inflammatory and anticancer properties. As with many heterocyclic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this compound represents a significant class of heterocycles with potential applications in drug development and materials science.

Formula: C₁₂H₁₄N₄O₄

InChI: InChI=1S/C12H14N4O4/c1-3-19-11(17)7-5-14-10-8(12(18)20-4-2)6-15-16(10)9(7)13/h5-6H,3-4,13H2,1-2H3

InChI key: InChIKey=NXFDIPGZEWOPDX-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=C2N(C(N)=C(C(OCC)=O)C=N2)N=C1

7-Aminopyrazolo[1,5-a]pyrimidine-3,6-dicarboxylic acid 3,6-diethyl ester

CAS: 43024-67-5

7-Aminopyrazolo[1,5-a]pyrimidine-3,6-dicarboxylic acid 3,6-diethyl ester is an impurity in the synthesis of drugs. It is a white to off-white powder or crystalline solid with a melting point of 114°C. 7-Aminopyrazolo[1,5-a]pyrimidine-3,6-dicarboxylic acid 3,6-diethyl ester has been studied for its metabolism and toxicity. It is not naturally occurring and was synthesized in the laboratory. It may be used as a reference material for pharmacopoeia standards.

Formula: C₁₂H₁₄N₄O₄

Purity: Min. 95%

Molecular weight: 278.26 g/mol

Ref: 3D-TBA02467