CAS 43027-41-4
:2-(chloromethyl)naphthalene-1,4-dione
Description:
2-(Chloromethyl)naphthalene-1,4-dione, with the CAS number 43027-41-4, is an organic compound characterized by its naphthalene backbone substituted with a chloromethyl group and two carbonyl groups (ketones) at the 1 and 4 positions. This compound typically appears as a solid at room temperature and is known for its potential reactivity due to the presence of the electrophilic carbonyl groups, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The chloromethyl group enhances its reactivity, making it useful in synthetic organic chemistry. Additionally, the compound may exhibit fluorescence properties, which can be exploited in various applications, including dye synthesis and as a fluorescent probe. Its solubility is generally moderate in organic solvents, and it may have specific applications in pharmaceuticals or materials science due to its unique structural features. As with many chlorinated compounds, it is essential to handle it with care, considering potential toxicity and environmental impact.
Formula:C11H7ClO2
InChI:InChI=1/C11H7ClO2/c12-6-7-5-10(13)8-3-1-2-4-9(8)11(7)14/h1-5H,6H2
SMILES:c1ccc2c(c1)C(=O)C=C(CCl)C2=O
Synonyms:- 1,4-Naphthalenedione, 2-(Chloromethyl)-
- 2-(Chloromethyl)-1,4-naphthoquinone
- 2-(Chloromethyl)naphthoquinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.