CAS 43029-70-5

4-hydroxy-4'-methylbiphenyl-3-carboxylic acid

Description:

4-Hydroxy-4'-methylbiphenyl-3-carboxylic acid, with the CAS number 43029-70-5, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a hydroxyl group (-OH) and a carboxylic acid group (-COOH) attached to the biphenyl framework, specifically at the 4 and 3 positions, respectively, along with a methyl group (-CH3) at the para position relative to the hydroxyl group. The presence of these functional groups contributes to its potential as a versatile intermediate in organic synthesis and materials science. It exhibits properties typical of aromatic compounds, such as stability and the ability to participate in electrophilic substitution reactions. Additionally, the hydroxyl and carboxylic acid groups can engage in hydrogen bonding, influencing its solubility and reactivity. This compound may also have applications in the development of pharmaceuticals, agrochemicals, or as a building block in polymer chemistry.

Formula: C₁₄H₁₂O₃

InChI: InChI=1/C14H12O3/c1-9-2-4-10(5-3-9)11-6-7-13(15)12(8-11)14(16)17/h2-8,15H,1H3,(H,16,17)

SMILES: Cc1ccc(cc1)c1ccc(c(c1)C(=O)O)O

Synonyms:

• [1,1'-Biphenyl]-3-carboxylic acid, 4-hydroxy-4'-methyl-
• 4-Hydroxy-4'-methylbiphenyl-3-carboxylic acid

4-Hydroxy-4'-methyl-[1,1'-biphenyl]-3-carboxylic acid

CAS: 43029-70-5

4-Hydroxy-4'-methyl-[1,1'-biphenyl]-3-carboxylic acid

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 228.24g/mol

Ref: 54-OR7431