CAS 43038-36-4

4-cyanobenzohydrazide

Description:

4-Cyanobenzohydrazide, with the CAS number 43038-36-4, is an organic compound characterized by the presence of both a hydrazide functional group and a cyano group attached to a benzene ring. This compound typically appears as a crystalline solid and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. It exhibits properties such as moderate solubility in polar solvents and may have specific reactivity due to the presence of the hydrazide and cyano functionalities, which can participate in condensation reactions and other chemical transformations. The compound's structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry. Safety data should be consulted, as it may pose hazards typical of hydrazine derivatives, including toxicity and potential carcinogenicity. Proper handling and storage conditions are essential to ensure safety when working with this substance.

Formula: C₈H₇N₃O

InChI: InChI=1/C8H7N3O/c9-5-6-1-3-7(4-2-6)8(12)11-10/h1-4H,10H2,(H,11,12)

SMILES: c1cc(ccc1C#N)C(=O)NN

Synonyms:

• Benzoic acid, 4-cyano-, hydrazide
• 4-Cyanobenzoylhydrazine

Benzoic acid, 4-cyano-, hydrazide (9CI)

CAS: 43038-36-4

Formula: C₈H₇N₃O

Purity: 95%

Color and Shape: Solid

Molecular weight: 161.1607

Ref: IN-DA00DCSD

4-Cyanobenzohydrazide

CAS: 43038-36-4

4-Cyanobenzohydrazide

Purity: 98%

Molecular weight: 161.16g/mol

Ref: 54-OR89840

4-Cyanobenzohydrazide

CAS: 43038-36-4

Formula: C₈H₇N₃O

Purity: 95%

Color and Shape: Solid

Molecular weight: 161.164

Ref: 10-F061263