CAS 43038-37-5
:2-Phenoxybenzoic acid hydrazide
Description:
2-Phenoxybenzoic acid hydrazide is an organic compound characterized by its hydrazide functional group attached to a phenoxybenzoic acid moiety. This compound typically appears as a white to off-white solid and is soluble in organic solvents, while its solubility in water may be limited. It is known for its potential applications in pharmaceuticals and agrochemicals, often serving as an intermediate in the synthesis of various bioactive compounds. The presence of both the phenoxy and hydrazide groups contributes to its reactivity, allowing for further chemical modifications. Additionally, 2-Phenoxybenzoic acid hydrazide may exhibit biological activities, including antimicrobial or anti-inflammatory properties, making it of interest in medicinal chemistry. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity. Overall, this compound represents a versatile building block in organic synthesis and medicinal applications.
Formula:C13H12N2O2
InChI:InChI=1S/C13H12N2O2/c14-15-13(16)11-8-4-5-9-12(11)17-10-6-2-1-3-7-10/h1-9H,14H2,(H,15,16)
InChI key:InChIKey=PIMAJOVNMMNVCZ-UHFFFAOYSA-N
SMILES:O(C1=C(C(NN)=O)C=CC=C1)C2=CC=CC=C2
Synonyms:- 2-Phenoxybenzohydrazide
- 2-Phenoxybenzoic acid hydrazide
- Benzoic acid, 2-phenoxy-, hydrazide
- 2-Phenoxybenzhydrazide
- JR-13915, 2-Phenoxybenzohydrazide, 97%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Phenoxybenzhydrazide
CAS:Formula:C13H12N2O2Purity:98%Color and Shape:SolidMolecular weight:228.24662-Phenoxybenzohydrazide
CAS:Formula:C13H12N2O2Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:228.252-Phenoxybenzoic acid hydrazide
CAS:2-Phenoxybenzoic acid hydrazide is a non-steroidal analgesic that binds to benzodiazepine receptors in the brain, which prevents the binding of GABA. The compound has been used as an analgesic in animal models and has been shown to have anti-inflammatory activities. It also has been found to possess pharmacological activity against muscle spasms and pain relief in rats. 2-phenoxybenzoic acid hydrazide was found to be more potent than other NSAIDs such as flumazenil, ketoprofen, and ibuprofen in its ability to produce analgesia. This agent is not active orally as it is metabolized by hepatic enzymes before it can reach the blood stream and brain.
Formula:C13H12N2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:228.25 g/mol2-Phenoxybenzhydrazide
CAS:Formula:C13H12N2O2Purity:98.0%Color and Shape:SolidMolecular weight:228.251




