CAS 430440-66-7
:sodium (2E)-4-(4-chlorophenyl)-4-hydroxybut-2-enoate hydrate
Description:
Sodium (2E)-4-(4-chlorophenyl)-4-hydroxybut-2-enoate hydrate, with the CAS number 430440-66-7, is a chemical compound that belongs to the class of sodium salts of hydroxybutenoic acids. This substance typically appears as a white to off-white crystalline powder and is soluble in water, which is a characteristic feature of many sodium salts. The presence of the 4-chlorophenyl group indicates that it may exhibit specific biological activities or interactions, potentially making it relevant in pharmaceutical applications. The hydroxy and enoate functional groups suggest that it may participate in various chemical reactions, including esterification or polymerization. As a hydrate, it contains water molecules in its crystalline structure, which can influence its stability and solubility. Safety data should be consulted for handling and usage, as with any chemical, to ensure proper precautions are taken. Overall, this compound's unique structure and properties may lend it utility in various chemical and biological contexts.
Formula:C10H10ClNaO4
InChI:InChI=1/C10H9ClO3.Na.H2O/c11-8-3-1-7(2-4-8)9(12)5-6-10(13)14;;/h1-6,9,12H,(H,13,14);;1H2/q;+1;/p-1/b6-5+;;
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
NCS-356 sodium
CAS:NCS-356 sodium is a GHB receptor agonist.Formula:C10H8ClNaO3Color and Shape:SolidMolecular weight:234.61
