CAS 430461-56-6: (3R)-3-phenylpiperidine
Description:(3R)-3-phenylpiperidine is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The "3R" designation indicates that the compound has a specific stereochemistry at the third carbon atom, which is substituted with a phenyl group, contributing to its unique properties. This compound is often studied in medicinal chemistry due to its potential pharmacological applications, particularly in the development of drugs targeting the central nervous system. Its structure allows for interactions with various biological receptors, making it of interest in the fields of neuropharmacology and drug design. The presence of the phenyl group enhances lipophilicity, which can influence the compound's bioavailability and ability to cross biological membranes. Additionally, (3R)-3-phenylpiperidine may exhibit specific chiral properties, affecting its interaction with biological systems and its overall efficacy as a therapeutic agent. As with many piperidine derivatives, it may also be involved in various synthetic pathways, making it a valuable intermediate in organic synthesis.
Formula:C11H15N
InChI:InChI=1/C11H15N/c1-2-5-10(6-3-1)11-7-4-8-12-9-11/h1-3,5-6,11-12H,4,7-9H2/t11-/m0/s1
- Synonyms:
- Piperidine, 3-phenyl-, (3R)-
- (R)-3-Phenyl Piperidine
- (3R)-3-Phenylpiperidine
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | (R)-3-Phenyl piperidine REF: 10-F038593CAS: 430461-56-6 | 95.0% | 57.00 €~1,536.00 € | Wed 09 Apr 25 |
 | R)-3-PHENYL PIPERIDINE REF: IN-DA00D950CAS: 430461-56-6 | 97% | To inquire | Tue 15 Apr 25 |
 | (R)-3-Phenylpiperidine REF: 54-OR321433CAS: 430461-56-6 | By hplc: 98.23% (Typical Value in Batch COA) | 285.00 €~830.00 € | Tue 22 Apr 25 |
 | (R)-3-Phenylpiperidine REF: 3D-FP154866CAS: 430461-56-6 | Min. 95% | - - - | Discontinued product |
(R)-3-Phenyl piperidine
Ref: 10-F038593
| 1g | 384.00 € | ||
| 5g | 1,536.00 € | ||
| 100mg | 57.00 € | ||
| 250mg | 108.00 € |
R)-3-PHENYL PIPERIDINE
Ref: IN-DA00D950
| 1g | 507.00 € | ||
| 5g | To inquire | ||
| 100mg | 92.00 € | ||
| 250mg | 135.00 € |
(R)-3-Phenylpiperidine
Ref: 54-OR321433
| 1g | 830.00 € | ||
| 250mg | 285.00 € |
(R)-3-Phenylpiperidine
Ref: 3D-FP154866
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
