CAS 430464-20-3

(5Z)-2-amino-5-(2-bromo-5-ethoxybenzylidene)-1,3-thiazol-4(5H)-one

Description:

(5Z)-2-amino-5-(2-bromo-5-ethoxybenzylidene)-1,3-thiazol-4(5H)-one is a thiazole derivative characterized by its unique structural features, including a thiazole ring, an amino group, and a benzylidene moiety with a bromine and ethoxy substituent. This compound typically exhibits biological activity, making it of interest in medicinal chemistry and drug development. The thiazole ring contributes to its potential reactivity and interaction with biological targets, while the bromine atom can enhance lipophilicity and influence the compound's pharmacokinetic properties. The ethoxy group may also affect solubility and stability. As a synthetic organic compound, it may be utilized in various research applications, including studies on enzyme inhibition or as a potential therapeutic agent. Its specific properties, such as melting point, solubility, and spectral characteristics, would be determined through experimental methods. Safety and handling precautions are essential due to the presence of bromine, which can pose health risks. Overall, this compound represents a complex structure with potential applications in pharmaceutical research.

Formula: C₁₂H₁₁BrN₂O₂S

InChI: InChI=1/C12H11BrN2O2S/c1-2-17-8-3-4-9(13)7(5-8)6-10-11(16)15-12(14)18-10/h3-6H,2H2,1H3,(H2,14,15,16)/b10-6-

SMILES: CCOc1ccc(c(c1)/C=C\1/C(=NC(=N)S1)O)Br

(5Z)-5-(2-bromo-5-ethoxybenzylidene)-2-imino-1,3-thiazolidin-4-one

CAS: 430464-20-3

Formula: C₁₂H₁₁BrN₂O₂S

Purity: 95.0%

Molecular weight: 327.2

Ref: 10-F315121