CAS 4305-74-2
:L-glycero-D-manno-heptose
Description:
L-glycero-D-manno-heptose is a seven-carbon sugar, specifically a heptose, that plays a significant role in the structure of certain bacterial lipopolysaccharides. It is an aldoheptose, meaning it contains an aldehyde functional group, and its configuration is characterized by the presence of both L- and D- stereoisomers. This compound is known for its involvement in the biosynthesis of polysaccharides and glycoproteins, contributing to the structural integrity and functionality of bacterial cell walls. L-glycero-D-manno-heptose is typically found in the outer membrane of Gram-negative bacteria, where it is crucial for maintaining the barrier function and mediating interactions with the host immune system. The presence of this sugar can influence the virulence of certain pathogens. In terms of physical properties, L-glycero-D-manno-heptose is a white crystalline solid that is soluble in water, reflecting its polar nature. Its chemical reactivity is primarily governed by the functional groups present, allowing for various biochemical interactions and modifications.
Formula:C7H14O7
InChI:InChI=1/C7H14O7/c8-1-3(10)5(12)7(14)6(13)4(11)2-9/h1,3-7,9-14H,2H2/t3-,4-,5-,6-,7+/m1/s1
Synonyms:- glycero-manno-Heptose
- D-glycero-D-manno-Heptose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
L-Glycero-D-mannoheptose
CAS:Controlled Product<p>Stability Hygroscopic<br>Applications L-Glycero-D-mannoheptose is a component of the O-antigenic lipopolysaccharide of Salmonella typhimurium and other gram-negative bacteria.<br>References Teuber, M., et al.: Biochemistry, 7, 9, 3303 (1968), Brade, H. & Galanos, C.: Infect. Immun., 42, 250 (1983),<br></p>Formula:C7H14O7Color and Shape:NeatMolecular weight:210.18L-Glycero-D-manno-heptose
CAS:<p>L-Glycero-D-manno-heptose is a polymyxin B antimicrobial agent that has been shown to have significant activity against Gram-positive bacteria, including Staphylococcus aureus and Streptococcus pneumoniae. This compound also has an inhibitory effect on the growth of Gram-negative species such as Salmonella enterica. L-Glycero-D-manno-heptose inhibits the synthesis of bacterial cell wall peptidoglycan by binding to the terminal residues of oligosaccharides, which are linked to D-alanine in the peptidoglycan chain. The terminal residues of oligosaccharides are transferred from the lipid carrier to L-glycero-D manno heptose, forming a stable acylated glycoside. This reaction mechanism is similar to that of polymyxin B, but with a difference in reactivity due to steric hindrance.</p>Formula:C7H14O7Purity:Min. 95%Color and Shape:White PowderMolecular weight:210.18 g/mol




