CymitQuimica logo

CAS 43051-43-0

:

N-[3-[Bis[2-(acetyloxy)ethyl]amino]phenyl]benzamide

Description:
N-[3-[Bis[2-(acetyloxy)ethyl]amino]phenyl]benzamide, with the CAS number 43051-43-0, is a synthetic organic compound characterized by its complex structure, which includes an amide functional group and multiple acetyloxyethyl substituents. This compound typically exhibits properties associated with both amides and aromatic systems, such as moderate solubility in organic solvents and potential interactions with biological systems due to its amine functionalities. The presence of the acetyloxy groups suggests that it may participate in esterification reactions or hydrolysis under certain conditions. Additionally, the compound's aromatic rings can contribute to its stability and may influence its electronic properties, making it of interest in various chemical and pharmaceutical applications. Its specific reactivity and interactions would depend on the surrounding environment, including pH and the presence of other reactive species. Overall, this compound exemplifies the complexity and versatility of synthetic organic molecules in medicinal chemistry and materials science.
Formula:C21H24N2O5
InChI:InChI=1S/C21H24N2O5/c1-16(24)27-13-11-23(12-14-28-17(2)25)20-10-6-9-19(15-20)22-21(26)18-7-4-3-5-8-18/h3-10,15H,11-14H2,1-2H3,(H,22,26)
InChI key:InChIKey=HOGOIYHXIXLXGA-UHFFFAOYSA-N
SMILES:N(CCOC(C)=O)(CCOC(C)=O)C1=CC(NC(=O)C2=CC=CC=C2)=CC=C1
Synonyms:
  • 3'-(N,N-Bis(acetoxyethyl)amino)benzanilide
  • 3′-[Bis(2-acetoxyethyl)amino]benzanilide
  • Benzamide, N-(3-(bis(2-(acetyloxy)ethyl)amino)phenyl)-
  • N-[3-[Bis[2-(acetyloxy)ethyl]amino]phenyl]benzamide
  • {[3-(Benzoylamino)Phenyl]Imino}Diethane-2,1-Diyl Diacetate
  • m-Benzamidophenyliminodiethyl diacetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.