CAS 4306-46-1

[4-(4-bromobenzoyl)phenyl] acetate

Description:

[4-(4-bromobenzoyl)phenyl] acetate, with the CAS number 4306-46-1, is an organic compound characterized by its aromatic structure and the presence of both an acetate and a bromobenzoyl functional group. This compound typically appears as a solid at room temperature and is soluble in organic solvents such as ethanol and acetone, but may have limited solubility in water due to its hydrophobic aromatic components. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and physical properties, such as melting point and boiling point. Additionally, the acetyl group contributes to its potential as an acylating agent in various chemical reactions. This compound may be of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its structural features that can facilitate further chemical modifications. Safety precautions should be observed when handling this substance, as it may pose health risks typical of halogenated organic compounds.

Formula: C₁₅H₁₁BrO₃

InChI: InChI=1/C15H11BrO3/c1-10(17)19-14-8-4-12(5-9-14)15(18)11-2-6-13(16)7-3-11/h2-9H,1H3

SMILES: CC(=O)Oc1ccc(cc1)C(=O)c1ccc(cc1)Br

4-Acetoxy-4′-bromobenzophenone

CAS: 4306-46-1

Formula: C₁₅H₁₁BrO₃

Purity: 90.0%

Molecular weight: 319.154

Ref: 10-F201850