CAS 43071-19-8
:2-(Dimethylaminomethyl)pyridine
Description:
2-(Dimethylaminomethyl)pyridine, with the CAS number 43071-19-8, is an organic compound characterized by its pyridine ring substituted with a dimethylaminomethyl group. This compound typically appears as a colorless to pale yellow liquid and possesses a distinctive amine-like odor. It is soluble in polar organic solvents, such as alcohols and ethers, but has limited solubility in water. The presence of the dimethylamino group imparts basic properties to the molecule, making it a potential nucleophile in various chemical reactions. It is often used as a ligand in coordination chemistry and as a catalyst in organic synthesis, particularly in reactions involving nucleophilic substitutions. Additionally, due to its structural features, it can participate in hydrogen bonding, influencing its reactivity and interactions with other chemical species. Safety precautions should be observed when handling this compound, as it may be irritating to the skin and eyes, and proper ventilation is recommended to avoid inhalation of vapors.
Formula:C8H12N2
InChI:InChI=1/C8H12N2/c1-10(2)7-8-5-3-4-6-9-8/h3-6H,7H2,1-2H3
SMILES:CN(C)Cc1ccccn1
Synonyms:- 2-[(Dimethylamino)methyl]pyridine
- N,N-Dimethyl-2-pyridinemethanamine
- N,N-dimethyl-1-(pyridin-2-yl)methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-(Dimethylaminomethyl)-pyridine
CAS:Controlled ProductApplications 2-(DIMETHYLAMINOMETHYL)-PYRIDINE (cas# 43071-19-8) is a useful research chemical.
Formula:C8H12N2Color and Shape:NeatMolecular weight:136.194

