CAS 43076-16-0
:4-(1-methylpiperidin-4-ylidene)-4H-benzo[4,5]cyclohepta[1,2-b]thiophene-9,10-dione
Description:
4-(1-Methylpiperidin-4-ylidene)-4H-benzo[4,5]cyclohepta[1,2-b]thiophene-9,10-dione, with the CAS number 43076-16-0, is a complex organic compound characterized by its unique structural features, including a benzo[4,5]cyclohepta core fused with a thiophene moiety and a piperidine substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may influence its reactivity and stability. The presence of the diketone functional groups (9,10-dione) suggests potential for reactivity in various chemical transformations, including nucleophilic addition and condensation reactions. Additionally, the piperidine ring can impart basicity and may participate in hydrogen bonding interactions. The compound's molecular structure may also confer interesting electronic properties, making it a candidate for applications in organic electronics or as a potential pharmaceutical agent. Its solubility, melting point, and other physical properties would depend on the specific conditions and solvents used. Overall, this compound represents a fascinating example of synthetic organic chemistry with potential implications in various fields.
Formula:C19H17NO2S
InChI:InChI=1/C19H17NO2S/c1-20-9-6-12(7-10-20)16-13-4-2-3-5-14(13)17(21)18(22)19-15(16)8-11-23-19/h2-5,8,11H,6-7,9-10H2,1H3
SMILES:CN1CCC(=C2c3ccccc3C(=O)C(=O)c3c2ccs3)CC1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
9,10-Dioxo Ketotifen
CAS:Controlled ProductImpurity Ketotifen EP Impurity G
Applications Ketotifen (K315100) impurity. The 9- and 10-oxo derivatives of Ketotifen as antihistaminics.
References Waldvogel, E., et al.: Helv. Chim. Acta, 59, 866 (1976),Formula:C19H17NO2SColor and Shape:Light Yellow To YellowMolecular weight:323.419,10-Dioxo ketotifen
CAS:9,10-Dioxo ketotifen is a drug product that belongs to the category of HPLC standards. It has been shown to be a metabolite of ketotifen and also an impurity in ketotifen. 9,10-Dioxo ketotifen has been shown to possess antihistamine activity and may have potential as a lead compound for the development of new drugs.Formula:C19H17NO2SPurity:Min. 95%Color and Shape:PowderMolecular weight:323.41 g/mol





