CAS 43077-30-1
:[(1S,2S,5R)-5-Methyl-2-(1-methylethyl)cyclohexyl]diphenylphosphine oxide
Description:
The chemical substance known as [(1S,2S,5R)-5-Methyl-2-(1-methylethyl)cyclohexyl]diphenylphosphine oxide, with the CAS number 43077-30-1, is a phosphine oxide compound characterized by its unique structural features. It contains a phosphine oxide functional group, which is characterized by a phosphorus atom bonded to an oxygen atom with a double bond, contributing to its reactivity and potential applications in various chemical reactions. The compound features a cyclohexyl ring with specific stereochemistry, indicated by the (1S,2S,5R) configuration, which can influence its physical and chemical properties, such as solubility and reactivity. The presence of two phenyl groups attached to the phosphorus atom enhances its steric bulk and may affect its interaction with other molecules. This compound is of interest in organic synthesis and catalysis, particularly in processes involving phosphine oxide derivatives. Its specific characteristics, including melting point, boiling point, and solubility, would typically be determined through experimental methods and may vary based on purity and environmental conditions.
Formula:C22H29OP
InChI:InChI=1S/C22H29OP/c1-17(2)21-15-14-18(3)16-22(21)24(23,19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-13,17-18,21-22H,14-16H2,1-3H3/t18-,21+,22+/m1/s1
InChI key:InChIKey=BPCNGVCAHAIZEE-COPCDDAFSA-N
SMILES:P(=O)([C@@H]1[C@H](C(C)C)CC[C@@H](C)C1)(C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- Dpo 1
- Phosphine oxide, [(1S,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl]diphenyl-
- Phosphine oxide, [5-methyl-2-(1-methylethyl)cyclohexyl]diphenyl-, [1S-(1α,2α,5β)]-
- Phosphorane, [(1S,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl]diphenyl-, oxide
- [(1S,2S,5R)-2-Isopropyl-5-methylcyclohexyl](diphenyl)phosphine oxide
- [(1S,2S,5R)-5-Methyl-2-(1-methylethyl)cyclohexyl]diphenylphosphine oxide



