CAS 431-09-4

2-chloro-2-fluoroacetamide

Description:

2-Chloro-2-fluoroacetamide is an organic compound characterized by the presence of both chlorine and fluorine atoms attached to the acetamide functional group. Its molecular formula is C2H2ClFNO, indicating it contains two carbon atoms, two hydrogen atoms, one chlorine atom, one fluorine atom, one nitrogen atom, and one oxygen atom. This compound typically appears as a colorless to pale yellow solid or liquid, depending on its purity and form. It is known for its role in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of both halogens (chlorine and fluorine) contributes to its reactivity and potential applications in chemical reactions, particularly in nucleophilic substitution processes. Additionally, 2-chloro-2-fluoroacetamide may exhibit specific biological activities, making it of interest in medicinal chemistry. However, handling this compound requires caution due to its potential toxicity and the need for appropriate safety measures in laboratory settings.

Formula: C₂H₃ClFNO

InChI: InChI=1/C2H3ClFNO/c3-1(4)2(5)6/h1H,(H2,5,6)

SMILES: C(C(=N)O)(Cl)F

Synonyms:

• Acetamide, 2-chloro-2-fluoro-
• 2-Chloro-2-fluoroacetamide

2-Chloro-2-fluoroacetamide

CAS: 431-09-4

2-Chloro-2-fluoroacetamide

Purity: 98%

Color and Shape: Liquid

Molecular weight: 111.50g/mol

Ref: 54-PC4293

Chlorofluoroacetamide

Controlled Product

CAS: 431-09-4

Applications CHLOROFLUOROACETAMIDE (cas# 431-09-4) is a useful research chemical.

Formula: C₂H₃ClFNO

Color and Shape: Neat

Molecular weight: 111.503

Ref: TR-C384248

Chlorofluoroacetamide

CAS: 431-09-4

Purity: 98.0%

Color and Shape: Solid

Molecular weight: 111.5

Ref: 10-F038384