
CAS 4310-89-8
:Isoquinolinium, 2,2′-(1,16-hexadecanediyl)bis-, chloride (1:2)
Description:
Isoquinolinium, 2,2′-(1,16-hexadecanediyl)bis-, chloride (1:2), with CAS number 4310-89-8, is a quaternary ammonium compound characterized by its isoquinolinium structure, which includes a long hydrocarbon chain derived from hexadecanediyl. This compound typically exhibits properties associated with quaternary ammonium salts, such as being a cationic surfactant, which can enhance solubility in organic solvents and provide antimicrobial activity. The presence of the long aliphatic chain contributes to its hydrophobic characteristics, while the isoquinolinium moiety imparts unique electronic properties. It is often utilized in various applications, including as a phase transfer catalyst, in drug delivery systems, and in the formulation of surfactants. The chloride ions associated with the compound serve to balance the positive charge of the isoquinolinium cation. Overall, this substance is notable for its potential applications in both industrial and pharmaceutical contexts, owing to its amphiphilic nature and ability to interact with biological membranes.
Formula:C34H46N2·2Cl
InChI:InChI=1S/C34H46N2.2ClH/c1(3-5-7-9-11-17-25-35-27-23-31-19-13-15-21-33(31)29-35)2-4-6-8-10-12-18-26-36-28-24-32-20-14-16-22-34(32)30-36;;/h13-16,19-24,27-30H,1-12,17-18,25-26H2;2*1H/q+2;;/p-2
InChI key:InChIKey=KZUZUJNAVUAVOW-UHFFFAOYSA-L
SMILES:C(CCCCCCCCCCCCCCC[N+]1=CC2=C(C=C1)C=CC=C2)[N+]3=CC4=C(C=C3)C=CC=C4.[Cl-]
Synonyms:- Isoquinolinium, 2,2′-(1,16-hexadecanediyl)bis-, chloride (1:2)
- Isoquinolinium, 2,2′-hexadecamethylenedi-, dichloride
- Isoquinolinium, 2,2′-(1,16-hexadecanediyl)bis-, dichloride
- 2,2′-Hexadecamethylenebis(isoquinolinium chloride)
- Isoquinolinium, 2,2′-hexadecamethylenebis-, dichloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Hedaquinium chloride
CAS:<p>Hedaquinium chloride has antibacterial activity.</p>Formula:C34H46Cl2N2Color and Shape:SolidMolecular weight:553.65
