CAS 43101-48-0
:1,4-Diethyl aspartate
Description:
1,4-Diethyl aspartate is an organic compound characterized by its structure, which features two ethyl groups attached to the nitrogen atoms of the aspartate backbone. This compound is a derivative of aspartic acid, an amino acid that plays a crucial role in various biological processes. 1,4-Diethyl aspartate is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in polar solvents, such as water and alcohols, due to the presence of the carboxylic acid group in its structure. The compound is of interest in medicinal chemistry and biochemistry, particularly for its potential applications in drug development and as a biochemical probe. Its properties, such as melting point, boiling point, and reactivity, can vary based on the specific conditions and purity of the sample. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H15NO4
InChI:InChI=1S/C8H15NO4/c1-3-12-7(10)5-6(9)8(11)13-4-2/h6H,3-5,9H2,1-2H3
InChI key:InChIKey=HMNXRLQSCJJMBT-UHFFFAOYSA-N
SMILES:C(C(C(OCC)=O)N)C(OCC)=O
Synonyms:- 1,4-Diethyl aspartate
- <span class="text-smallcaps">DL</span>-Aspartic acid, diethyl ester
- Aspartic acid, 1,4-diethyl ester
- Aspartic acid, diethyl ester
- Diethyl 2-aminosuccinate
- Diethyl <span class="text-smallcaps">DL</span>-aspartate
- Diethyl aspartate
- O,O-Diethyl-<span class="text-smallcaps">DL</span>-aspartic acid
- DL-Aspartic acid, diethyl ester
- Diethyl DL-aspartate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Aspartic Acid Diethyl Ester
CAS:Controlled ProductFormula:C8H15NO4·HClColor and Shape:WhiteMolecular weight:225.62
