
CAS 43129-74-4
:3,6-Acridinediol
Description:
3,6-Acridinediol, with the CAS number 43129-74-4, is an organic compound characterized by its acridine backbone, which is a tricyclic aromatic structure. This compound features two hydroxyl (-OH) groups located at the 3 and 6 positions of the acridine ring, contributing to its chemical reactivity and potential biological activity. 3,6-Acridinediol is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of hydroxyl groups. The compound is of interest in various fields, including medicinal chemistry, where it may serve as a precursor for the synthesis of pharmaceuticals or as a potential therapeutic agent due to its structural properties. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the purity and specific conditions under which it is studied. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C13H9NO2
InChI:InChI=1S/C13H9NO2/c15-10-3-1-8-5-9-2-4-11(16)7-13(9)14-12(8)6-10/h1-7,15-16H
InChI key:InChIKey=LXFYIIKDJZNGST-UHFFFAOYSA-N
SMILES:OC1=CC2=C(C=C3C(=N2)C=C(O)C=C3)C=C1
Synonyms:- 3,6-Dihydroxyacridine
- 3,6-Acridinediol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Acridine-3,6-diol
CAS:Acridine-3,6-diol is a dye chemical.Formula:C13H9NO2Color and Shape:SolidMolecular weight:211.22
