CAS 43134-09-4
:1,3-bis(4-(dimethylamino)phenyl)-2,4-di-hydroxycy
Description:
1,3-bis(4-(dimethylamino)phenyl)-2,4-dihydroxycy, identified by its CAS number 43134-09-4, is an organic compound characterized by its complex molecular structure featuring two dimethylamino groups and hydroxyl functionalities. This compound typically exhibits properties such as high solubility in organic solvents and potential applications in dye chemistry due to its chromophoric characteristics. The presence of dimethylamino groups contributes to its electron-donating ability, enhancing its reactivity and stability in various chemical environments. Additionally, the hydroxyl groups can participate in hydrogen bonding, influencing the compound's physical properties, such as melting point and boiling point. This substance may also display interesting optical properties, making it suitable for applications in organic electronics or as a dye in various industries. However, specific safety and handling guidelines should be followed, as with any chemical substance, to mitigate potential hazards associated with its use.
Formula:C20H20N2O2
InChI:InChI=1/C20H22N2O2/c1-21(2)15-9-5-13(6-10-15)17-19(23)18(20(17)24)14-7-11-16(12-8-14)22(3)4/h5-12,23-24H,1-4H3/p-2
SMILES:CN(C)c1ccc(cc1)C1=C(C(=C1[O-])c1ccc(cc1)N(C)C)[O-]
Synonyms:- 1,3-Bis[4-(Dimethylamino)Phenyl]-2,4-Dioxidocyclobutane-1,2,3,4-Tetrayl
- 1,3-Bis[4-(dimethylamino)phenyl]-2,4-dihydroxycyclobutenediylium dihydroxide, bis(inner salt)
- 2,4-Bis[4-(N,N-dimethylamino)phenyl]squaraine
- 2-Cyclobuten-1-ylium, 1,3-bis[p-(dimethylamino)phenyl]-2-hydroxy-4-oxo-, hydroxide, inner salt
- Bis[4-(dimethylamino)phenyl]squaraine
- Cyclobutenediylium, 1,3-bis[4-(dimethylamino)phenyl]-2,4-dihydroxy-, bis(inner salt)
- NSC 125878
- Squarylium III
- Squarylium dye III
- 1,3-BIS(4-DIMETHYLAMINO-PHENYL)-2-OXO-CYCLOBUTEYYLIUM-4-OLAT
- 1,3-bis(4-(dimethylamino)phenyl)-2,4-di-hydroxycy
- 1-(4-Dimethylamino-phenyl)-3-(4-dimethylimmonium-cyclohexa-2,5-dien-1-ylidene)-2-oxo-cyclobuten-4-olate
- 1,3-BIS(4-(DIMETHYLAMINO)PHENYL)-2,4-DI- HYDROXYCYCLOBUTENEDIYLIUM DIHYDROXIDE
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1,3-Bis[4-(dimethylamino)phenyl]-2,4-dihydroxycyclobutenediylium dihydroxide, bis(inner salt)
CAS:Formula:C20H20N2O2Molecular weight:320.3850

