CAS 43138-64-3

3-O-Methyl-1,2:5,6-bis-O-(1-methylethylidene)-α-D-glucofuranose

Description:

3-O-Methyl-1,2:5,6-bis-O-(1-methylethylidene)-α-D-glucofuranose is a chemical compound that belongs to the class of glycosides, specifically a derivative of glucose. It features a furanose ring structure, which is a five-membered cyclic form of sugar, and is characterized by the presence of two methylethylidene groups and a methyl ether at the 3-position. This compound is typically used in organic synthesis and carbohydrate chemistry due to its unique structural properties, which can influence reactivity and solubility. The presence of the methylethylidene groups enhances its stability and can affect its interactions with other molecules. As a sugar derivative, it may exhibit biological activity, potentially influencing enzymatic reactions or serving as a substrate for various biochemical processes. Its specific applications and behavior in chemical reactions would depend on the context of use, including conditions such as pH, temperature, and the presence of catalysts or other reactants.

Formula: C₁₃H₂₂O₆

InChI: InChI=1S/C13H22O6/c1-12(2)15-6-7(17-12)8-9(14-5)10-11(16-8)19-13(3,4)18-10/h7-11H,6H2,1-5H3/t7-,8-,9+,10-,11-/m1/s1

InChI key: InChIKey=GPNUVPVTXHBPJI-KAMPLNKDSA-N

SMILES: O(C)[C@H]1[C@](O[C@]2([C@@]1(OC(C)(C)O2)[H])[H])([C@]3(COC(C)(C)O3)[H])[H]

Synonyms:

• Glucofuranose, 1,2:5,6-di-O-isopropylidene-3-O-methyl-
• α-D-Glucofuranose, 3-O-methyl-1,2:5,6-bis-O-(1-methylethylidene)-
• Furo[2,3-d]-1,3-dioxole, α-D-glucofuranose deriv.
• 1,2:5,6-Diisopropylidene-3-O-methyl-α-D-glucofuranose
• 3-O-Methyl-1,2:5,6-bis-O-(1-methylethylidene)-α-D-glucofuranose

1,2:5,6-Di-O-isopropylidene-3-O-methyl-a-D-glucofuranose

CAS: 43138-64-3

1,2:5,6-Di-O-isopropylidene-3-O-methyl-a-D-glucofuranose is a glycosylation agent that belongs to the group of complex carbohydrates. It is a synthetic compound that can be modified with methyl groups, fluorine atoms, or click modification. 1,2:5,6-Di-O-isopropylidene-3-O-methyl-a-D-glucofuranose is used as a monosaccharide for the synthesis of oligosaccharides and polysaccharides. This compound has high purity and can be custom synthesized to meet customer specifications.

Formula: C₁₃H₂₂O₆

Purity: Min. 95%

Molecular weight: 274.31 g/mol

Ref: 3D-MD32503