CAS 4314-22-1

1H-1,2,3-triazol-1-ylacetic acid

Description:

1H-1,2,3-Triazol-1-ylacetic acid, with the CAS number 4314-22-1, is a heterocyclic organic compound characterized by the presence of a triazole ring and an acetic acid functional group. This compound features a five-membered ring containing three nitrogen atoms and two carbon atoms, which contributes to its unique chemical properties. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. The triazole moiety imparts notable biological activity, making it of interest in pharmaceutical research, particularly for its potential as an antimicrobial or antifungal agent. Additionally, the compound can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it valuable in synthetic organic chemistry. Its stability and reactivity can be influenced by the pH of the environment, and it may exhibit different properties in various solvents or under different conditions.

Formula: C₄H₅N₃O₂

InChI: InChI=1S/C4H5N3O2/c8-4(9)3-7-2-1-5-6-7/h1-2H,3H2,(H,8,9)

InChI key: InChIKey=YUHHBTFHHCASIC-UHFFFAOYSA-N

SMILES: c1cn(CC(=O)O)nn1

1H-1,2,3 Triazole-1-acetic acid

CAS: 4314-22-1

Formula: C₄H₅N₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 127.1014

Ref: IN-DA00D9VW

2-(1H-1,2,3-Triazol-1-yl)acetic acid

CAS: 4314-22-1

2-(1H-1,2,3-Triazol-1-yl)acetic acid

Purity: 98%

Molecular weight: 127.10g/mol

Ref: 54-OR73868

1H-1,2,3-Triazole-1-Acetic Acid

CAS: 4314-22-1

Formula: C₄H₅N₃O₂

Molecular weight: 127.10

Ref: 4Z-T-270007

1H-1,2,3-Triazole-1-acetic Acid

Controlled Product

CAS: 4314-22-1

Applications 1H-1,2,3-Triazole-1-acetic acid (cas# 4314-22-1) is a useful research chemical.

Formula: C₄H₅N₃O₂

Color and Shape: White To Off-White

Molecular weight: 127.1

Ref: TR-T767545

1H-1,2,3-triazol-1-ylacetic acid

CAS: 4314-22-1

Formula: C₄H₅N₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 127.103

Ref: 10-F311114