CAS 43142-58-1
:(3E)-3-ethylidenedihydrofuran-2(3H)-one
Description:
(3E)-3-ethylidenedihydrofuran-2(3H)-one, identified by its CAS number 43142-58-1, is an organic compound characterized by its unique structure, which includes a furan ring and a ketone functional group. This compound features a double bond at the 3-position of the furan, contributing to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid with a distinctive odor. The presence of the ethylidene group enhances its chemical reactivity, making it a candidate for various chemical transformations, including polymerization and condensation reactions. Its solubility in organic solvents suggests it can be utilized in various chemical processes. Additionally, compounds of this type may exhibit biological activity, which could be of interest in medicinal chemistry. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C6H8O2
InChI:InChI=1/C6H8O2/c1-2-5-3-4-8-6(5)7/h2H,3-4H2,1H3/b5-2+
Synonyms:- (3E)-3-Ethylidenedihydrofuran-2(3H)-one
- 2(3H)-furanone, 3-ethylidenedihydro-, (3E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
