CAS 43152-58-5
:4-hydroxy-5-undecyl-1,3-benzothiazole-6,7-dione
Description:
4-Hydroxy-5-undecyl-1,3-benzothiazole-6,7-dione, with the CAS number 43152-58-5, is a chemical compound characterized by its unique structure that includes a benzothiazole core, which is a bicyclic compound containing both sulfur and nitrogen. This compound features a hydroxyl group (-OH) and a long undecyl chain, contributing to its hydrophobic properties. The presence of the dione functional groups indicates that it has two carbonyl groups (C=O) within its structure, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The compound is likely to exhibit biological activity, potentially serving as a dye or a precursor in organic synthesis due to its chromophoric properties. Its solubility and reactivity may vary depending on the solvent and conditions used. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, this compound's unique structural features make it of interest in both synthetic chemistry and potential applications in materials science.
Formula:C18H25NO3S
InChI:InChI=1/C18H25NO3S/c1-2-3-4-5-6-7-8-9-10-11-13-15(20)14-18(23-12-19-14)17(22)16(13)21/h12,20H,2-11H2,1H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
UHDBT
CAS:UHDBT acts as an inhibitor of the cytochrome bc1 complex Qo site, utilized in electron transfer research [1].Formula:C18H25NO3SColor and Shape:SolidMolecular weight:335.46
