CAS 43153-04-4

Ethyl 4-formyl-α-methylbenzeneacetate

Description:

Ethyl 4-formyl-α-methylbenzeneacetate, identified by its CAS number 43153-04-4, is an organic compound that belongs to the class of esters. It features a structure that includes an ethyl ester group, a formyl group, and a substituted aromatic ring, specifically a methyl group on the benzene ring. This compound is typically characterized by its moderate volatility and potential solubility in organic solvents, making it useful in various chemical applications. Ethyl 4-formyl-α-methylbenzeneacetate may exhibit reactivity typical of aldehydes and esters, such as undergoing condensation reactions or participating in nucleophilic additions. Its aromatic structure can also contribute to unique electronic properties, influencing its behavior in chemical reactions. While specific physical properties such as boiling point, melting point, and density may vary, they are generally consistent with those of similar ester compounds. This substance may find applications in organic synthesis, fragrance formulation, or as an intermediate in the production of more complex molecules.

Formula: C₁₂H₁₄O₃

InChI: InChI=1S/C12H14O3/c1-3-15-12(14)9(2)11-6-4-10(8-13)5-7-11/h4-9H,3H2,1-2H3

InChI key: InChIKey=KQPWKBOJHTURNH-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)(C)C1=CC=C(C=O)C=C1

Synonyms:

• Benzeneacetic acid, 4-formyl-α-methyl-, ethyl ester
• Ethyl 4-formyl-α-methylbenzeneacetate