CymitQuimica logo

CAS 43161-30-4

:

Cyclopropanecarboxylic acid, 1-(bromomethyl)-, methyl ester

Description:
Cyclopropanecarboxylic acid, 1-(bromomethyl)-, methyl ester is an organic compound characterized by its cyclopropane ring structure, which contributes to its unique chemical properties. This compound features a carboxylic acid functional group and a bromomethyl substituent, which can influence its reactivity and interactions with other molecules. The presence of the methyl ester group indicates that it can undergo hydrolysis to yield the corresponding acid and methanol. The bromomethyl group can serve as a site for nucleophilic substitution reactions, making the compound potentially useful in synthetic organic chemistry. Additionally, the cyclopropane ring introduces angle strain, which can affect the stability and reactivity of the molecule. This compound may be of interest in various applications, including pharmaceuticals and agrochemicals, due to its unique structural features and potential reactivity. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.
Formula:C6H9BrO2
InChI:InChI=1S/C6H9BrO2/c1-9-5(8)6(4-7)2-3-6/h2-4H2,1H3
InChI key:GPFGVZAQKJPYAT-UHFFFAOYSA-N
SMILES:COC(=O)C1(CC1)CBr
Found 5 products.