CAS 43167-40-4

N-acetyl-5-methoxy-L-tryptophan

Description:

N-acetyl-5-methoxy-L-tryptophan is a derivative of the amino acid tryptophan, characterized by the presence of an acetyl group and a methoxy group at specific positions on the indole ring. This compound is known for its potential biological activities, including roles in neurotransmitter synthesis and modulation of mood. It is soluble in polar solvents, which is typical for amino acid derivatives, and exhibits a relatively stable structure under standard conditions. The methoxy group enhances its lipophilicity, potentially influencing its bioavailability and interaction with biological membranes. N-acetyl-5-methoxy-L-tryptophan may also exhibit antioxidant properties, contributing to its relevance in various biochemical and pharmacological studies. Its unique structure allows it to participate in various metabolic pathways, making it a subject of interest in research related to mental health and neurochemistry. As with many tryptophan derivatives, it may also be investigated for its effects on serotonin levels and overall mood regulation.

Formula: C₁₄H₁₆N₂O₄

InChI: InChI=1/C14H16N2O4/c1-8(17)16-13(14(18)19)5-9-7-15-12-4-3-10(20-2)6-11(9)12/h3-4,6-7,13,15H,5H2,1-2H3,(H,16,17)(H,18,19)/t13-/m0/s1

SMILES: CC(=N[C@@H](Cc1c[nH]c2ccc(cc12)OC)C(=O)O)O

2-acetamido-3-(5-methoxy-1H-indol-3-yl)propanoic acid

CAS: 43167-40-4

Formula: C₁₄H₁₆N₂O₄

Molecular weight: 276.2878

Ref: IN-DA000FGU

N-Acetyl-5-methoxy-DL-tryptophan monohydrate

CAS: 43167-40-4

N-Acetyl-5-methoxy-DL-tryptophan monohydrate (AMT) is a fine chemical that is used as a versatile building block in the synthesis of more complex compounds.

Formula: C₁₄H₁₈N₂O₅

Molecular weight: 294.31 g/mol

Ref: 3D-A-1478