CAS 43167-79-9
:2,4-Dianilino-6-(4-morpholinyl)-1,3,5-triazine
Description:
2,4-Dianilino-6-(4-morpholinyl)-1,3,5-triazine, with the CAS number 43167-79-9, is a chemical compound that belongs to the class of triazines, which are characterized by a six-membered ring containing three nitrogen atoms. This compound features two aniline groups and a morpholine substituent, contributing to its unique properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the aniline groups suggests potential applications in dye chemistry or as intermediates in organic synthesis, while the morpholine ring may impart additional functional properties, such as improved solubility or reactivity. The compound's structure allows for various interactions, making it of interest in fields such as pharmaceuticals, agrochemicals, or materials science. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 2,4-Dianilino-6-(4-morpholinyl)-1,3,5-triazine represents a versatile compound with potential applications in various chemical industries.
Formula:C19H20N6O
InChI:InChI=1/C19H20N6O/c1-3-7-15(8-4-1)20-17-22-18(21-16-9-5-2-6-10-16)24-19(23-17)25-11-13-26-14-12-25/h1-10H,11-14H2,(H2,20,21,22,23,24)
SMILES:c1ccc(cc1)N=c1[nH]c(=Nc2ccccc2)[nH]c(n1)N1CCOCC1
Synonyms:- 1,3,5-Triazine-2,4-diamine, 6-(4-morpholinyl)-N~2~,N~4~-diphenyl-
- 6-(morpholin-4-yl)-N,N'-diphenyl-1,3,5-triazine-2,4-diamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2,4-Dianilino-6-(4-morpholinyl)-1,3,5-triazine, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C19H20N6OPurity:97%Color and Shape:White to cream, Powder or crystalline powderMolecular weight:348.41

