CAS 43170-89-4
:2-methylthioadenosine triphosphate*tetrasodium
Description:
2-Methylthioadenosine triphosphate tetrasodium, with the CAS number 43170-89-4, is a nucleotide analog that plays a significant role in biochemical processes, particularly in the context of cellular metabolism and signaling. This compound is characterized by the presence of a methylthio group, which is a sulfur-containing moiety that can influence its biological activity and interactions. As a triphosphate, it contains three phosphate groups, which are crucial for energy transfer and storage in cells. The tetrasodium salt form indicates that it is neutralized with sodium ions, enhancing its solubility in aqueous solutions, which is important for its use in various biochemical assays and research applications. 2-Methylthioadenosine triphosphate is often utilized in studies related to enzymatic reactions, signal transduction pathways, and as a substrate in the synthesis of other nucleotides. Its structural features contribute to its function in cellular processes, making it a valuable compound in biochemistry and molecular biology.
Formula:C11H18N5O13P3S
InChI:InChI=1/C11H18N5O13P3S/c1-33-11-14-8(12)5-9(15-11)16(3-13-5)10-7(18)6(17)4(27-10)2-26-31(22,23)29-32(24,25)28-30(19,20)21/h3-4,6-7,10,17-18H,2H2,1H3,(H,22,23)(H,24,25)(H2,12,14,15)(H2,19,20,21)/t4-,6-,7-,10?/m1/s1
SMILES:CSc1nc(c2c(n1)n(cn2)C1[C@@H]([C@@H]([C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O1)O)O)N
Synonyms:- 2-Methylthio-ATP
- 2-Mesatp
- 2-Methylthio-adenosine 5'-triphosphate
- Mesatp cpd
- Adenosine 5'-(tetrahydrogen triphosphate), 2-(methylthio)-
- 2-(Methylsulfanyl)Adenosine 5'-(Tetrahydrogen Triphosphate)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Methylthioadenosine Triphosphate Triethylamine Salt
CAS:Controlled ProductFormula:C11H18N5O13P3S•x(C6H15N)Color and Shape:NeatMolecular weight:553.27 + x(101.19)2-Methylthioadenosine-5'-triphosphate
CAS:2-Methylthioadenosine-5'-triphosphate (2MeSATP) is a nucleotide analogue that inhibits the synthesis of ATP by binding to the adenylate cyclase enzyme. 2MeSATP has been shown to be a potent inhibitor of neuronal death and is used as a tool in cellular research. 2MeSATP binds to guanine nucleotide-binding protein (G protein), which inhibits its activity and prevents the activation of other downstream enzymes, such as phospholipase C, which are necessary for neurotransmitter release. 2MeSATP also has an inhibitory effect on several other enzymes, including phosphodiesterases and cyclases, in cellular models and whole cells.Formula:C11H18N5O13P3SPurity:Min. 95%Molecular weight:553.27 g/mol

