CAS 43179-09-5

(2R,3S,5R)-2-aminotetrahydropyran-3,4,5-triol

Description:

(2R,3S,5R)-2-aminotetrahydropyran-3,4,5-triol is a chemical compound characterized by its specific stereochemistry and functional groups. It features a tetrahydropyran ring, which is a six-membered cyclic ether with five carbon atoms and one oxygen atom. The presence of an amino group (-NH2) at the second carbon position contributes to its basicity and potential reactivity in various chemical reactions. The three hydroxyl groups (-OH) located at the 3, 4, and 5 positions of the ring enhance its hydrophilicity, making it soluble in water and reactive in biological systems. This compound is of interest in medicinal chemistry and biochemistry due to its potential role as a building block in the synthesis of more complex molecules, including carbohydrates and pharmaceuticals. Its stereochemical configuration is crucial for its biological activity, influencing how it interacts with enzymes and receptors in living organisms. Overall, (2R,3S,5R)-2-aminotetrahydropyran-3,4,5-triol is a versatile compound with significant implications in various fields of research.

Formula: C₅H₁₁NO₄

InChI: InChI=1/C5H11NO4/c6-5-4(9)3(8)2(7)1-10-5/h2-5,7-9H,1,6H2/t2-,3?,4+,5-/m1/s1

D-Ribopyranosylamine

CAS: 43179-09-5

Molecular weight: 149.15

Ref: 7W-GC9765

D-Ribopyranosylamine

Controlled Product

CAS: 43179-09-5

Stability Hygroscopic
Applications D-Ribopyranosylamine (cas# 43179-09-5) is a compound useful in organic synthesis.

Formula: C₅H₁₁NO₄

Color and Shape: Neat

Molecular weight: 149.15

Ref: TR-R416850

D-Ribopyranosyl amine

CAS: 43179-09-5

D-Ribopyranosyl amine is a heterocyclic compound that can be synthesized from ethyl formate and thiourea. The synthesis of this compound has been studied using techniques such as hydrogen bonding, high yield, and optical rotation. D-Ribopyranosyl amine is an aminoimidazole derivative with a decarboxylation reaction to produce uridine. This process can be carried out in acetone or dimethylformamide solvent, which produces the α-form of the molecule. The 1H NMR spectra of D-ribopyranosyl amine have peaks at 3.8 ppm, 2.5 ppm, and 2.0 ppm, while the 13C NMR spectrum peaks are found at 79.2 ppm and 131.9 ppm

Formula: C₅H₁₁NO₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 149.15 g/mol

Ref: 3D-MR09649