CAS 4318-42-7
:Isopropylpiperazine
Description:
Isopropylpiperazine is an organic compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features an isopropyl group attached to one of the nitrogen atoms in the piperazine ring, contributing to its unique properties. Isopropylpiperazine is typically a colorless to pale yellow liquid with a relatively low boiling point, indicating it is volatile. It is soluble in water and various organic solvents, making it versatile for different applications. The compound is primarily studied for its potential use in pharmaceuticals, particularly as a building block in the synthesis of various bioactive molecules. Additionally, isopropylpiperazine may exhibit psychoactive properties, which have drawn interest in the field of medicinal chemistry. However, safety and handling precautions are essential due to its potential effects and the need for proper storage conditions to maintain its stability. As with many chemical substances, understanding its reactivity and interactions with other compounds is crucial for its safe application in research and industry.
Formula:C7H16N2
InChI:InChI=1S/C7H16N2/c1-7(2)9-5-3-8-4-6-9/h7-8H,3-6H2,1-2H3
InChI key:InChIKey=WHKWMTXTYKVFLK-UHFFFAOYSA-N
SMILES:C(C)(C)N1CCNCC1
Synonyms:- 1-(1-Methylethyl)piperazine
- 1-(2-Propyl)-piperazine
- 1-(Propan-2-Yl)Piperazine
- 4-(Propan-2-yl)piperazine
- 4-Isopropylpiperazine
- Iflab-Bb F1929-1669
- Isopropylpiperazine
- N-Isopropylpiperazine
- N-Isopropypiperazine
- N-isopropylpiperizine
- Piperazine, 1-(1-methylethyl)-
- Piperazine, 1-isopropyl-
- Rarechem Ah Ck 0183
- Timtec-Bb Sbb004236
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Isopropylpiperazine
CAS:Formula:C7H16N2Purity:>98.0%(GC)(T)Color and Shape:Colorless to Light orange to Yellow clear liquidMolecular weight:128.22Ref: IN-DA0032SK
1g26.00€5g34.00€10g47.00€1kgTo inquire25g79.00€50g122.00€100g165.00€500gTo inquire250mg22.00€1-(Isopropyl)piperazine
CAS:1-(Isopropyl)piperazineFormula:C7H16N2Purity:97%Color and Shape: clear. faint yellow liquidMolecular weight:128.21534g/mol1-Isopropylpiperazine
CAS:1-Isopropylpiperazine is a quinoline derivative that is an antimicrobial agent. It has been shown to be effective against inflammatory bowel disease, bowel disease, and trioxane. 1-Isopropylpiperazine inhibits the activity of kinases and amines, which are molecules involved in inflammation. This drug also has molecular modeling properties that show potent inhibition of the enzyme histidine kinase. 1-Isopropylpiperazine's molecular modeling properties may be due to its ability to bind to the active site of the enzyme histidine kinase, which is adjacent to a hydrophobic pocket containing the catalytic residues.Formula:C7H16N2Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:128.22 g/mol




