CAS 43189-37-3

(R)-Amino-(4-chlorophenyl)acetic acid

Description:

(R)-Amino-(4-chlorophenyl)acetic acid, also known as (R)-4-chlorophenylglycine, is an amino acid derivative characterized by its chiral center, which imparts specific stereochemical properties. This compound features a phenyl ring substituted with a chlorine atom at the para position, contributing to its unique electronic and steric characteristics. The presence of the amino group (-NH2) and the carboxylic acid group (-COOH) makes it an amino acid, allowing it to participate in various biochemical reactions. It is often studied for its potential applications in pharmaceuticals, particularly as a building block in the synthesis of biologically active compounds. The (R) configuration is significant in determining the compound's interaction with biological systems, influencing its efficacy and safety profile. Additionally, (R)-Amino-(4-chlorophenyl)acetic acid may exhibit specific solubility properties in polar solvents due to its functional groups, and its stability can be affected by pH and temperature conditions. Overall, this compound is of interest in medicinal chemistry and biochemistry for its potential therapeutic applications.

Formula: C₈H₈ClNO₂

InChI: InChI=1/C8H8ClNO2/c9-6-3-1-5(2-4-6)7(10)8(11)12/h1-4,7H,10H2,(H,11,12)/t7-/m1/s1

SMILES: c1cc(ccc1[C@H](C(=O)O)N)Cl

Synonyms:

• (2R)-amino(4-chlorophenyl)ethanoic acid
• (R)-4-chlorophenyl glycine
• (R)-2-(4-Chlorophenyl)glycine
• D(-)-4-Chlorophenylglycine
• H-D-Phg(4-Cl)-OH

(R)-4-CHLORO PHENYLGLYCINE

CAS: 43189-37-3

Formula: C₈H₈ClNO₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 185.6076

Ref: IN-DA00D955

H-D-Phg(4-Cl)-OH

CAS: 43189-37-3

H-D-Phg(4-Cl)-OH

Purity: 95%

Molecular weight: 185.61g/mol

Ref: 54-OR1006509

D-4-Chlorophenylglycine

CAS: 43189-37-3

Formula: C₈H₈ClNO₂

Purity: 96%

Color and Shape: Solid, White powder

Molecular weight: 185.61

Ref: 10-F034310