CAS 43192-33-2

4-Bromo-2-methoxybenzaldehyde

Description:

4-Bromo-2-methoxybenzaldehyde is an organic compound characterized by its aromatic structure, which includes a bromine atom and a methoxy group attached to a benzaldehyde moiety. This compound features a bromine substituent at the para position and a methoxy group at the ortho position relative to the aldehyde functional group. It is typically a pale yellow to light brown solid at room temperature and is soluble in organic solvents such as ethanol and dichloromethane, but has limited solubility in water. The presence of the bromine atom contributes to its reactivity, making it useful in various chemical synthesis applications, including the preparation of pharmaceuticals and agrochemicals. The methoxy group enhances its electron-donating properties, influencing its reactivity and interaction with other chemical species. Additionally, 4-Bromo-2-methoxybenzaldehyde can undergo typical electrophilic aromatic substitution reactions, making it a valuable intermediate in organic synthesis. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.

Formula: C₈H₇BrO₂

InChI: InChI=1/C8H7BrO2/c1-11-8-4-7(9)3-2-6(8)5-10/h2-5H,1H3

SMILES: COc1cc(ccc1C=O)Br

Synonyms:

• Benzaldehyde, 4-bromo-2-methoxy-

4-Bromo-2-methoxybenzaldehyde

CAS: 43192-33-2

Formula: C₈H₇BrO₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 215.0440

Ref: IN-DA00DAG8

4-Bromo-2-methoxybenzaldehyde

CAS: 43192-33-2

4-Bromo-2-methoxybenzaldehyde

Purity: 97%

Color and Shape: Solid

Molecular weight: 215.04g/mol

Ref: 54-OR40709

4-Bromo-2-methoxybenzaldehyde

CAS: 43192-33-2

Formula: C₈H₇BrO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 215.046

Ref: 10-F078674