CAS 431995-26-5

N-(2-bromophenyl)-2-[4-(propan-2-yl)phenoxy]acetamide

Description:

N-(2-bromophenyl)-2-[4-(propan-2-yl)phenoxy]acetamide, with the CAS number 431995-26-5, is a chemical compound characterized by its complex structure, which includes a brominated aromatic ring and an acetamide functional group. This compound features a 2-bromophenyl moiety, which contributes to its potential biological activity, and a phenoxy group that is substituted with an isopropyl group, enhancing its lipophilicity. The presence of the acetamide group suggests that it may exhibit properties typical of amides, such as hydrogen bonding capabilities. The compound's molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique combination of functional groups that may interact with biological targets. Additionally, the bromine atom may influence the compound's reactivity and stability, making it of interest for further studies in organic synthesis and drug design. Overall, this compound exemplifies the intricate relationship between molecular structure and biological activity in chemical research.

Formula: C₁₇H₁₈BrNO₂

InChI: InChI=1/C17H18BrNO2/c1-12(2)13-7-9-14(10-8-13)21-11-17(20)19-16-6-4-3-5-15(16)18/h3-10,12H,11H2,1-2H3,(H,19,20)

SMILES: CC(C)c1ccc(cc1)OCC(=Nc1ccccc1Br)O

Synonyms:

• acetamide, N-(2-bromophenyl)-2-[4-(1-methylethyl)phenoxy]-
• N-(2-Bromophenyl)-2-(4-isopropylphenoxy)acetamide

N-(2-bromophenyl)-2-(4-isopropylphenoxy)acetamide

CAS: 431995-26-5

Formula: C₁₇H₁₈BrNO₂

Purity: 95.0%

Molecular weight: 348.24

Ref: 10-F315186