CAS 43200-83-5
:3-(5-Chloropyrid-2-yl)carbamoylpyrazine-2-carboxylic acid
Description:
3-(5-Chloropyrid-2-yl)carbamoylpyrazine-2-carboxylic acid is a chemical compound characterized by its complex structure, which includes a pyrazine ring and a chloropyridine moiety. This compound features a carboxylic acid functional group, contributing to its acidic properties, and a carbamoyl group that enhances its potential for hydrogen bonding and reactivity. The presence of the chlorine atom on the pyridine ring can influence the compound's electronic properties and biological activity, potentially affecting its solubility and interaction with biological targets. The molecular structure suggests that it may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 3-(5-Chloropyrid-2-yl)carbamoylpyrazine-2-carboxylic acid is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C11H7ClN4O3
InChI:InChI=1S/C11H7ClN4O3/c12-6-1-2-7(15-5-6)16-10(17)8-9(11(18)19)14-4-3-13-8/h1-5H,(H,18,19)(H,15,16,17)
InChI key:InChIKey=IFJKAXKRMIJQHS-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(Cl)C=N1)(=O)C=2C(C(O)=O)=NC=CN2
Synonyms:- 3-(5-Chloropyrid-2-yl)carbamoylpyrazine-2-carboxylic acid
- 3-[[(5-Chloro-2-pyridinyl)amino]carbonyl]-2-pyrazinecarboxylic acid
- 2-Pyrazinecarboxylic acid, 3-[[(5-chloro-2-pyridinyl)amino]carbonyl]-
- Pyrazinecarboxylic acid, 3-[[(5-chloro-2-pyridinyl)amino]carbonyl]-
- 3-(5-Chloropyridin-2-yl)carbamylpyrazine-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Zopiclone Impurity 6
CAS:Formula:C11H7ClN4O3Color and Shape:White To Off-White SolidMolecular weight:278.653-(5-Chloropyridine-2-carbamoyl)-2-pyrazinecarboxylic Acid
CAS:Controlled ProductFormula:C11H7ClN4O3Color and Shape:NeatMolecular weight:278.653-[[(5-Chloro-2-pyridinyl)amino]carbonyl]-2-pyrazinecarboxylic Acid
CAS:Controlled ProductFormula:C11H7ClN4O3Color and Shape:NeatMolecular weight:278.65



