CymitQuimica logo

CAS 43200-88-0

:

Carbonic acid, 6-(5-chloro-2-pyridinyl)-6,7-dihydro-7-oxo-5H-pyrrolo[3,4-b]pyrazin-5-yl phenyl ester

Description:
Carbonic acid, 6-(5-chloro-2-pyridinyl)-6,7-dihydro-7-oxo-5H-pyrrolo[3,4-b]pyrazin-5-yl phenyl ester, identified by CAS number 43200-88-0, is a chemical compound characterized by its complex structure, which includes a pyridinyl group and a pyrrolo[3,4-b]pyrazin moiety. This compound typically exhibits properties associated with both carbonic acids and esters, such as potential acidity due to the presence of the carbonic acid functional group and reactivity due to the ester linkage. The presence of the chloro substituent may influence its biological activity and solubility. Additionally, the compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of heterocyclic rings that are often found in biologically active compounds. Its stability, solubility, and reactivity would depend on the specific conditions and solvents used. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C18H11ClN4O4
InChI:InChI=1S/C18H11ClN4O4/c19-11-6-7-13(22-10-11)23-16(24)14-15(21-9-8-20-14)17(23)27-18(25)26-12-4-2-1-3-5-12/h1-10,17H
InChI key:InChIKey=NCGZEYCAQLHEII-UHFFFAOYSA-N
SMILES:O(C(OC1=CC=CC=C1)=O)C2N(C(=O)C=3C2=NC=CN3)C4=CC=C(Cl)C=N4
Synonyms:
  • Carbonic acid, 6-(5-chloro-2-pyridinyl)-6,7-dihydro-7-oxo-5H-pyrrolo[3,4-b]pyrazin-5-yl phenyl ester
  • 5H-Pyrrolo[3,4-b]pyrazine, carbonic acid deriv.
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.