CymitQuimica logo

CAS 432001-45-1

:

(3-formyl-2-methyl-1H-indol-1-yl)acetic acid

Description:
(3-formyl-2-methyl-1H-indol-1-yl)acetic acid, identified by its CAS number 432001-45-1, is a chemical compound that features an indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound possesses a formyl group (-CHO) and an acetic acid moiety (-COOH), contributing to its reactivity and potential biological activity. The presence of the methyl group at the 2-position of the indole ring influences its electronic properties and steric hindrance. The carboxylic acid functional group can participate in hydrogen bonding and may enhance solubility in polar solvents. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structural characteristics suggest potential applications in drug development, particularly in the synthesis of indole derivatives, which are known for their diverse biological activities. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C12H11NO3
InChI:InChI=1/C12H11NO3/c1-8-10(7-14)9-4-2-3-5-11(9)13(8)6-12(15)16/h2-5,7H,6H2,1H3,(H,15,16)
InChI key:SPDRKMLFDFIREG-UHFFFAOYSA-N
SMILES:Cc1c(C=O)c2ccccc2n1CC(=O)O
Found 5 products.