
CAS 4322-58-1
:3,3′-[(2-Chlorophenyl)methylene]bis[4-hydroxy-2H-1-benzopyran-2-one]
Description:
3,3′-[(2-Chlorophenyl)methylene]bis[4-hydroxy-2H-1-benzopyran-2-one], commonly referred to as a derivative of flavonoids, is a synthetic compound characterized by its complex structure that includes two benzopyran moieties linked by a methylene bridge. This compound features a chlorophenyl group, which contributes to its unique chemical properties and potential biological activities. The presence of hydroxyl groups enhances its solubility and reactivity, making it a subject of interest in various fields, including medicinal chemistry and pharmacology. Its structural attributes suggest potential antioxidant and anti-inflammatory properties, typical of many flavonoid derivatives. The compound's CAS number, 4322-58-1, allows for easy identification in chemical databases. As with many synthetic organic compounds, its stability, reactivity, and interactions with biological systems can vary based on environmental conditions and the presence of other substances. Further research is often necessary to fully elucidate its potential applications and mechanisms of action in biological contexts.
Formula:C25H15ClO6
InChI:InChI=1S/C25H15ClO6/c26-16-10-4-1-7-13(16)19(20-22(27)14-8-2-5-11-17(14)31-24(20)29)21-23(28)15-9-3-6-12-18(15)32-25(21)30/h1-12,19,27-28H
InChI key:InChIKey=XJJPVDONOLMSOS-UHFFFAOYSA-N
SMILES:C(C1=C(O)C=2C(OC1=O)=CC=CC2)(C3=C(O)C=4C(OC3=O)=CC=CC4)C5=C(Cl)C=CC=C5
Synonyms:- 3,3′-(2-Chlorophenylmethylene)bis(4-hydroxy-2H-chromen-2-one)
- 2H-1-Benzopyran-2-one, 3,3′-[(2-chlorophenyl)methylene]bis[4-hydroxy-
- 3,3′-[(2-Chlorophenyl)methylene]bis[4-hydroxy-2H-1-benzopyran-2-one]
- Coumarin, 3,3′-(o-chlorobenzylidene)bis[4-hydroxy-
- 3,3′-((2-chlorophenyl)methylene)bis(4-hydroxy-2H-chromen-2-one)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3,3'-((2-Chlorophenyl)methylene)bis(4-hydroxy-2H-chromen-2-one)
CAS:3,3'-((2-Cl-phenyl)methylene)bis(4-OH-2H-chromen-2-one): ENPP1 inhibitor, Ki=50μM; urease inhibitor, IC50=84.53μM.Formula:C25H15ClO6Color and Shape:SolidMolecular weight:446.84
